C21H20O2S — CID 50916407
1,3-bis(4-methoxyphenyl)-2-methylsulfanylbenzene (PubChem CID 50916407) has the molecular formula C21H20O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-2-methylsulfanylbenzene.
| Compound Name | 1,3-bis(4-methoxyphenyl)-2-methylsulfanylbenzene |
|---|---|
| PubChem CID | 50916407 |
| Molecular Formula | C21H20O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-2-methylsulfanylbenzene |
| SMILES | COc1ccc(-c2cccc(-c3ccc(OC)cc3)c2SC)cc1 |
| InChI | InChI=1S/C21H20O2S/c1-22-17-11-7-15(8-12-17)19-5-4-6-20(21(19)24-3)16-9-13-18(23-2)14-10-16/h4-14H,1-3H3 |
| InChIKey | DZTWQPUJXIEBAT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |