C16H18O — CID 132540116
5-(4-methoxyphenyl)-1,2,3-trimethylbenzene (PubChem CID 132540116) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1,2,3-trimethylbenzene.
| Compound Name | 5-(4-methoxyphenyl)-1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 132540116 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 5-(4-methoxyphenyl)-1,2,3-trimethylbenzene |
| SMILES | COc1ccc(-c2cc(C)c(C)c(C)c2)cc1 |
| InChI | InChI=1S/C16H18O/c1-11-9-15(10-12(2)13(11)3)14-5-7-16(17-4)8-6-14/h5-10H,1-4H3 |
| InChIKey | VZWNHJQBOCLLJP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |