C20H19FNO+ — CID 154594189
2-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,6-dimethylpyridin-1-ium (PubChem CID 154594189) has the molecular formula C20H19FNO+ and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,6-dimethylpyridin-1-ium.
| Compound Name | 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,6-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 154594189 |
| Molecular Formula | C20H19FNO+ |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-1,6-dimethylpyridin-1-ium |
| SMILES | COc1ccc(-c2cc(C)[n+](C)c(-c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C20H19FNO/c1-14-12-17(15-6-10-19(23-3)11-7-15)13-20(22(14)2)16-4-8-18(21)9-5-16/h4-13H,1-3H3/q+1 |
| InChIKey | WVKGHTLMYDVBDT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|