C32H31FIN3O — CID 154594311
4-[4-[(E)-2-[6-(4-fluorophenyl)-4-(4-methoxyphenyl)-1-methylpyridin-1-ium-2-yl]ethenyl]-N-methylanilino]butanenitrile iodide (PubChem CID 154594311) has the molecular formula C32H31FIN3O and a molecular weight of 619.52 g/mol. Its IUPAC name is 4-[4-[(E)-2-[6-(4-fluorophenyl)-4-(4-methoxyphenyl)-1-methylpyridin-1-ium-2-yl]ethenyl]-N-methylanilino]butanenitrile iodide.
| Compound Name | 4-[4-[(E)-2-[6-(4-fluorophenyl)-4-(4-methoxyphenyl)-1-methylpyridin-1-ium-2-yl]ethenyl]-N-methylanilino]butanenitrile iodide |
|---|---|
| PubChem CID | 154594311 |
| Molecular Formula | C32H31FIN3O |
| Molecular Weight | 619.52 g/mol |
| Exact Mass | 619.15 |
| IUPAC Name | 4-[4-[(E)-2-[6-(4-fluorophenyl)-4-(4-methoxyphenyl)-1-methylpyridin-1-ium-2-yl]ethenyl]-N-methylanilino]butanenitrile iodide |
| SMILES | COc1ccc(-c2cc(/C=C/c3ccc(N(C)CCCC#N)cc3)[n+](C)c(-c3ccc(F)cc3)c2)cc1.[I-] |
| InChI | InChI=1S/C32H31FN3O.HI/c1-35(21-5-4-20-34)29-15-6-24(7-16-29)8-17-30-22-27(25-11-18-31(37-3)19-12-25)23-32(36(30)2)26-9-13-28(33)14-10-26;/h6-19,22-23H,4-5,21H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | QUMBEHCEXCKLOH-UHFFFAOYSA-M |
| XLogP | 3.91 |
| TPSA | 40.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|