C30H29Br2N2O2+ — CID 154594234
[2-bromo-5-[2-(4-bromophenyl)-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1-methylpyridin-1-ium-4-yl]-3-methoxyphenyl]methanol (PubChem CID 154594234) has the molecular formula C30H29Br2N2O2+ and a molecular weight of 609.38 g/mol. Its IUPAC name is [2-bromo-5-[2-(4-bromophenyl)-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1-methylpyridin-1-ium-4-yl]-3-methoxyphenyl]methanol.
| Compound Name | [2-bromo-5-[2-(4-bromophenyl)-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1-methylpyridin-1-ium-4-yl]-3-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 154594234 |
| Molecular Formula | C30H29Br2N2O2+ |
| Molecular Weight | 609.38 g/mol |
| Exact Mass | 607.06 |
| IUPAC Name | [2-bromo-5-[2-(4-bromophenyl)-6-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]-1-methylpyridin-1-ium-4-yl]-3-methoxyphenyl]methanol |
| SMILES | COc1cc(-c2cc(/C=C/c3ccc(N(C)C)cc3)[n+](C)c(-c3ccc(Br)cc3)c2)cc(CO)c1Br |
| InChI | InChI=1S/C30H29Br2N2O2/c1-33(2)26-12-5-20(6-13-26)7-14-27-16-23(22-15-24(19-35)30(32)29(18-22)36-4)17-28(34(27)3)21-8-10-25(31)11-9-21/h5-18,35H,19H2,1-4H3/q+1 |
| InChIKey | JQCFSCQRZRJVDG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 36.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.38 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|