C31H32BrIN2 — CID 154594173
4-[(E)-2-[4-(4-bromophenyl)-6-(4-methylphenyl)-1-propylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide (PubChem CID 154594173) has the molecular formula C31H32BrIN2 and a molecular weight of 639.42 g/mol. Its IUPAC name is 4-[(E)-2-[4-(4-bromophenyl)-6-(4-methylphenyl)-1-propylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide.
| Compound Name | 4-[(E)-2-[4-(4-bromophenyl)-6-(4-methylphenyl)-1-propylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide |
|---|---|
| PubChem CID | 154594173 |
| Molecular Formula | C31H32BrIN2 |
| Molecular Weight | 639.42 g/mol |
| Exact Mass | 638.08 |
| IUPAC Name | 4-[(E)-2-[4-(4-bromophenyl)-6-(4-methylphenyl)-1-propylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline iodide |
| SMILES | CCC[n+]1c(/C=C/c2ccc(N(C)C)cc2)cc(-c2ccc(Br)cc2)cc1-c1ccc(C)cc1.[I-] |
| InChI | InChI=1S/C31H32BrN2.HI/c1-5-20-34-30(19-10-24-8-17-29(18-9-24)33(3)4)21-27(25-13-15-28(32)16-14-25)22-31(34)26-11-6-23(2)7-12-26;/h6-19,21-22H,5,20H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RSCNHFCLHPULRC-UHFFFAOYSA-M |
| XLogP | 5.03 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|