C31H32BrN2+ — CID 154594174
4-[(E)-2-[4-(4-bromophenyl)-6-(4-methylphenyl)-1-propylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 154594174) has the molecular formula C31H32BrN2+ and a molecular weight of 512.52 g/mol. Its IUPAC name is 4-[(E)-2-[4-(4-bromophenyl)-6-(4-methylphenyl)-1-propylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[4-(4-bromophenyl)-6-(4-methylphenyl)-1-propylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 154594174 |
| Molecular Formula | C31H32BrN2+ |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 4-[(E)-2-[4-(4-bromophenyl)-6-(4-methylphenyl)-1-propylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CCC[n+]1c(/C=C/c2ccc(N(C)C)cc2)cc(-c2ccc(Br)cc2)cc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C31H32BrN2/c1-5-20-34-30(19-10-24-8-17-29(18-9-24)33(3)4)21-27(25-13-15-28(32)16-14-25)22-31(34)26-11-6-23(2)7-12-26/h6-19,21-22H,5,20H2,1-4H3/q+1 |
| InChIKey | IRBWSZXDDGNSBY-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|