C32H32Br2N+ — CID 154594113
2,4-bis(4-bromophenyl)-1-(2-methylpropyl)-6-[(E)-2-(4-propan-2-ylphenyl)ethenyl]pyridin-1-ium (PubChem CID 154594113) has the molecular formula C32H32Br2N+ and a molecular weight of 590.42 g/mol. Its IUPAC name is 2,4-bis(4-bromophenyl)-1-(2-methylpropyl)-6-[(E)-2-(4-propan-2-ylphenyl)ethenyl]pyridin-1-ium.
| Compound Name | 2,4-bis(4-bromophenyl)-1-(2-methylpropyl)-6-[(E)-2-(4-propan-2-ylphenyl)ethenyl]pyridin-1-ium |
|---|---|
| PubChem CID | 154594113 |
| Molecular Formula | C32H32Br2N+ |
| Molecular Weight | 590.42 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | 2,4-bis(4-bromophenyl)-1-(2-methylpropyl)-6-[(E)-2-(4-propan-2-ylphenyl)ethenyl]pyridin-1-ium |
| SMILES | CC(C)C[n+]1c(/C=C/c2ccc(C(C)C)cc2)cc(-c2ccc(Br)cc2)cc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H32Br2N/c1-22(2)21-35-31(18-7-24-5-8-25(9-6-24)23(3)4)19-28(26-10-14-29(33)15-11-26)20-32(35)27-12-16-30(34)17-13-27/h5-20,22-23H,21H2,1-4H3/q+1/b18-7+ |
| InChIKey | GQFFRICUBMKSBV-CNHKJKLMSA-N |
| XLogP | 9.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.42 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|