C33H27Br2N2+ — CID 154594161
4-[(E)-2-[4,6-bis(4-bromophenyl)-1-phenylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 154594161) has the molecular formula C33H27Br2N2+ and a molecular weight of 611.40 g/mol. Its IUPAC name is 4-[(E)-2-[4,6-bis(4-bromophenyl)-1-phenylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[4,6-bis(4-bromophenyl)-1-phenylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 154594161 |
| Molecular Formula | C33H27Br2N2+ |
| Molecular Weight | 611.40 g/mol |
| Exact Mass | 609.05 |
| IUPAC Name | 4-[(E)-2-[4,6-bis(4-bromophenyl)-1-phenylpyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2cc(-c3ccc(Br)cc3)cc(-c3ccc(Br)cc3)[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H27Br2N2/c1-36(2)30-19-8-24(9-20-30)10-21-32-22-27(25-11-15-28(34)16-12-25)23-33(26-13-17-29(35)18-14-26)37(32)31-6-4-3-5-7-31/h3-23H,1-2H3/q+1 |
| InChIKey | QXSDTMUYOJEWEB-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.40 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|