C32H25BF4N2O2 — CID 73183879
1-(4-methylphenyl)-2-[2-(4-nitrophenyl)ethenyl]-4,6-diphenylpyridin-1-ium tetrafluoroborate (PubChem CID 73183879) has the molecular formula C32H25BF4N2O2 and a molecular weight of 556.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-[2-(4-nitrophenyl)ethenyl]-4,6-diphenylpyridin-1-ium tetrafluoroborate.
| Compound Name | 1-(4-methylphenyl)-2-[2-(4-nitrophenyl)ethenyl]-4,6-diphenylpyridin-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 73183879 |
| Molecular Formula | C32H25BF4N2O2 |
| Molecular Weight | 556.37 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | 1-(4-methylphenyl)-2-[2-(4-nitrophenyl)ethenyl]-4,6-diphenylpyridin-1-ium tetrafluoroborate |
| SMILES | Cc1ccc(-[n+]2c(C=Cc3ccc([N+](=O)[O-])cc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C32H25N2O2.BF4/c1-24-12-17-29(18-13-24)33-31(21-16-25-14-19-30(20-15-25)34(35)36)22-28(26-8-4-2-5-9-26)23-32(33)27-10-6-3-7-11-27;2-1(3,4)5/h2-23H,1H3;/q+1;-1 |
| InChIKey | NZAPEONYJNIKGW-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 47.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.37 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|