C19H17BF4N2O4 — CID 10251734
5-(4-methoxyphenyl)-2-methyl-3-[(E)-2-(4-nitrophenyl)ethenyl]-1,2-oxazol-2-ium tetrafluoroborate (PubChem CID 10251734) has the molecular formula C19H17BF4N2O4 and a molecular weight of 424.16 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-methyl-3-[(E)-2-(4-nitrophenyl)ethenyl]-1,2-oxazol-2-ium tetrafluoroborate.
| Compound Name | 5-(4-methoxyphenyl)-2-methyl-3-[(E)-2-(4-nitrophenyl)ethenyl]-1,2-oxazol-2-ium tetrafluoroborate |
|---|---|
| PubChem CID | 10251734 |
| Molecular Formula | C19H17BF4N2O4 |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-methyl-3-[(E)-2-(4-nitrophenyl)ethenyl]-1,2-oxazol-2-ium tetrafluoroborate |
| SMILES | COc1ccc(-c2cc(/C=C/c3ccc([N+](=O)[O-])cc3)[n+](C)o2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C19H17N2O4.BF4/c1-20-17(10-5-14-3-8-16(9-4-14)21(22)23)13-19(25-20)15-6-11-18(24-2)12-7-15;2-1(3,4)5/h3-13H,1-2H3;/q+1;-1/b10-5+; |
| InChIKey | BBRZGIFZOMEDPX-OAZHBLANSA-N |
| XLogP | 5.16 |
| TPSA | 69.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|