C20H21BF4N2O — CID 10430587
N,N-dimethyl-4-[(E)-2-(2-methyl-5-phenyl-1,2-oxazol-2-ium-3-yl)ethenyl]aniline tetrafluoroborate (PubChem CID 10430587) has the molecular formula C20H21BF4N2O and a molecular weight of 392.21 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-(2-methyl-5-phenyl-1,2-oxazol-2-ium-3-yl)ethenyl]aniline tetrafluoroborate.
| Compound Name | N,N-dimethyl-4-[(E)-2-(2-methyl-5-phenyl-1,2-oxazol-2-ium-3-yl)ethenyl]aniline tetrafluoroborate |
|---|---|
| PubChem CID | 10430587 |
| Molecular Formula | C20H21BF4N2O |
| Molecular Weight | 392.21 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-(2-methyl-5-phenyl-1,2-oxazol-2-ium-3-yl)ethenyl]aniline tetrafluoroborate |
| SMILES | CN(C)c1ccc(/C=C/c2cc(-c3ccccc3)o[n+]2C)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C20H21N2O.BF4/c1-21(2)18-12-9-16(10-13-18)11-14-19-15-20(23-22(19)3)17-7-5-4-6-8-17;2-1(3,4)5/h4-15H,1-3H3;/q+1;-1 |
| InChIKey | MVYMWRKMPFKZHN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.21 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|