C20H20BF4N3O3 — CID 10455730
N,N-dimethyl-4-[(E)-2-[2-methyl-5-(4-nitrophenyl)-1,2-oxazol-2-ium-3-yl]ethenyl]aniline tetrafluoroborate (PubChem CID 10455730) has the molecular formula C20H20BF4N3O3 and a molecular weight of 437.20 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[2-methyl-5-(4-nitrophenyl)-1,2-oxazol-2-ium-3-yl]ethenyl]aniline tetrafluoroborate.
| Compound Name | N,N-dimethyl-4-[(E)-2-[2-methyl-5-(4-nitrophenyl)-1,2-oxazol-2-ium-3-yl]ethenyl]aniline tetrafluoroborate |
|---|---|
| PubChem CID | 10455730 |
| Molecular Formula | C20H20BF4N3O3 |
| Molecular Weight | 437.20 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[2-methyl-5-(4-nitrophenyl)-1,2-oxazol-2-ium-3-yl]ethenyl]aniline tetrafluoroborate |
| SMILES | CN(C)c1ccc(/C=C/c2cc(-c3ccc([N+](=O)[O-])cc3)o[n+]2C)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C20H20N3O3.BF4/c1-21(2)17-9-4-15(5-10-17)6-11-19-14-20(26-22(19)3)16-7-12-18(13-8-16)23(24)25;2-1(3,4)5/h4-14H,1-3H3;/q+1;-1 |
| InChIKey | QDRSPRBWZVNXNH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.20 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|