C26H22N2O2S3 — CID 10696425
N,N-dimethyl-4-[(E)-2-[5-[5-[(E)-2-(4-nitrophenyl)ethenyl]thiophen-2-yl]sulfanylthiophen-2-yl]ethenyl]aniline (PubChem CID 10696425) has the molecular formula C26H22N2O2S3 and a molecular weight of 490.68 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[5-[5-[(E)-2-(4-nitrophenyl)ethenyl]thiophen-2-yl]sulfanylthiophen-2-yl]ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[(E)-2-[5-[5-[(E)-2-(4-nitrophenyl)ethenyl]thiophen-2-yl]sulfanylthiophen-2-yl]ethenyl]aniline |
|---|---|
| PubChem CID | 10696425 |
| Molecular Formula | C26H22N2O2S3 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[5-[5-[(E)-2-(4-nitrophenyl)ethenyl]thiophen-2-yl]sulfanylthiophen-2-yl]ethenyl]aniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccc(Sc3ccc(/C=C/c4ccc([N+](=O)[O-])cc4)s3)s2)cc1 |
| InChI | InChI=1S/C26H22N2O2S3/c1-27(2)21-9-3-19(4-10-21)7-13-23-15-17-25(31-23)33-26-18-16-24(32-26)14-8-20-5-11-22(12-6-20)28(29)30/h3-18H,1-2H3/b13-7+,14-8+ |
| InChIKey | XIWYJDVSEILBSD-FNCQTZNRSA-N |
| XLogP | 8.28 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|