About 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine
4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine (PubChem CID 87898824) has the molecular formula C15H18N4O3
and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine.
Molecular Properties
| Compound Name | 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine |
| PubChem CID | 87898824 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine |
| SMILES | CN(C)c1ccc(C=O)cc1.NNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H11NO.C6H7N3O2/c1-10(2)9-5-3-8(7-11)4-6-9;7-8-5-1-3-6(4-2-5)9(10)11/h3-7H,1-2H3;1-4,8H,7H2 |
| InChIKey | HDBLUXOVSNRWDK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine?
The IUPAC name of 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine (CID 87898824) is 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine.
What is the SMILES notation for 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine?
The canonical SMILES for 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine is CN(C)c1ccc(C=O)cc1.NNc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine?
The InChIKey is HDBLUXOVSNRWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO.C6H7N3O2/c1-10(2)9-5-3-8(7-11)4-6-9;7-8-5-1-3-6(4-2-5)9(10)11/h3-7H,1-2H3;1-4,8H,7H2.
What are the key properties of 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine?
4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine has a molecular weight of 302.33 g/mol, XLogP of 2.45, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)benzaldehyde;(4-nitrophenyl)hydrazine is sourced from PubChem (CID 87898824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).