C24H14N2O4S3 — CID 101114775
4,10-bis[(E)-2-(4-nitrophenyl)ethenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 101114775) has the molecular formula C24H14N2O4S3 and a molecular weight of 490.59 g/mol. Its IUPAC name is 4,10-bis[(E)-2-(4-nitrophenyl)ethenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,10-bis[(E)-2-(4-nitrophenyl)ethenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 101114775 |
| Molecular Formula | C24H14N2O4S3 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.01 |
| IUPAC Name | 4,10-bis[(E)-2-(4-nitrophenyl)ethenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2cc3sc4cc(/C=C/c5ccc([N+](=O)[O-])cc5)sc4c3s2)cc1 |
| InChI | InChI=1S/C24H14N2O4S3/c27-25(28)17-7-1-15(2-8-17)5-11-19-13-21-23(31-19)24-22(33-21)14-20(32-24)12-6-16-3-9-18(10-4-16)26(29)30/h1-14H/b11-5+,12-6+ |
| InChIKey | QTOYPRXYOLFQFE-YDWXAUTNSA-N |
| XLogP | 8.33 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|