C18H15BClF4NO — CID 10430063
5-(4-chlorophenyl)-2-methyl-3-[(E)-2-phenylethenyl]-1,2-oxazol-2-ium tetrafluoroborate (PubChem CID 10430063) has the molecular formula C18H15BClF4NO and a molecular weight of 383.58 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-methyl-3-[(E)-2-phenylethenyl]-1,2-oxazol-2-ium tetrafluoroborate.
| Compound Name | 5-(4-chlorophenyl)-2-methyl-3-[(E)-2-phenylethenyl]-1,2-oxazol-2-ium tetrafluoroborate |
|---|---|
| PubChem CID | 10430063 |
| Molecular Formula | C18H15BClF4NO |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 5-(4-chlorophenyl)-2-methyl-3-[(E)-2-phenylethenyl]-1,2-oxazol-2-ium tetrafluoroborate |
| SMILES | C[n+]1oc(-c2ccc(Cl)cc2)cc1/C=C/c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C18H15ClNO.BF4/c1-20-17(12-7-14-5-3-2-4-6-14)13-18(21-20)15-8-10-16(19)11-9-15;2-1(3,4)5/h2-13H,1H3;/q+1;-1/b12-7+; |
| InChIKey | OOQRRDWXUVLMHC-RRAJOLSVSA-N |
| XLogP | 5.89 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|