C30H23BF4N4O2 — CID 12915377
4-nitro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide tetrafluoroborate (PubChem CID 12915377) has the molecular formula C30H23BF4N4O2 and a molecular weight of 558.34 g/mol. Its IUPAC name is 4-nitro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide tetrafluoroborate.
| Compound Name | 4-nitro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide tetrafluoroborate |
|---|---|
| PubChem CID | 12915377 |
| Molecular Formula | C30H23BF4N4O2 |
| Molecular Weight | 558.34 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | 4-nitro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide tetrafluoroborate |
| SMILES | F[B-](F)(F)F.N/C(=N\[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H23N4O2.BF4/c31-30(25-16-18-27(19-17-25)34(35)36)32-33-28(23-12-6-2-7-13-23)20-26(22-10-4-1-5-11-22)21-29(33)24-14-8-3-9-15-24;2-1(3,4)5/h1-21H,(H2,31,32);/q+1;-1 |
| InChIKey | MYSPHFFPEMXUQV-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.34 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|