[[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate

C8H7N3O5 — CID 91326336

IUPAC[[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate
SMILESNC(=NOC(=O)O)c1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C8H7N3O5/c9-7(10-16-8(12)13)5-1-3-6(4-2-5)11(14)15/h1-4H,(H2,9,10)(H,12,13)
InChIKeyQSTDIJAXVNTEPX-UHFFFAOYSA-N
MW225.16 g/mol
LogP0.91
Rot. Bonds3

About [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate

[[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate (PubChem CID 91326336) has the molecular formula C8H7N3O5 and a molecular weight of 225.16 g/mol. Its IUPAC name is [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate.

Molecular Properties

Compound Name[[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate
PubChem CID91326336
Molecular FormulaC8H7N3O5
Molecular Weight225.16 g/mol
Exact Mass225.04
IUPAC Name[[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate
SMILESNC(=NOC(=O)O)c1ccc([N+](=O)[O-])cc1
InChIInChI=1S/C8H7N3O5/c9-7(10-16-8(12)13)5-1-3-6(4-2-5)11(14)15/h1-4H,(H2,9,10)(H,12,13)
InChIKeyQSTDIJAXVNTEPX-UHFFFAOYSA-N
XLogP0.91
TPSA128.05 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.16
LogP ≤ 50.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate?
The IUPAC name of [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate (CID 91326336) is [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate.
What is the SMILES notation for [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate?
The canonical SMILES for [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate is NC(=NOC(=O)O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate?
The InChIKey is QSTDIJAXVNTEPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O5/c9-7(10-16-8(12)13)5-1-3-6(4-2-5)11(14)15/h1-4H,(H2,9,10)(H,12,13).
What are the key properties of [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate?
[[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate has a molecular weight of 225.16 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate is sourced from PubChem (CID 91326336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).