C8H7N3O5 — CID 91326336
[[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate (PubChem CID 91326336) has the molecular formula C8H7N3O5 and a molecular weight of 225.16 g/mol. Its IUPAC name is [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate.
| Compound Name | [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate |
|---|---|
| PubChem CID | 91326336 |
| Molecular Formula | C8H7N3O5 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | [[amino-(4-nitrophenyl)methylidene]amino] hydrogen carbonate |
| SMILES | NC(=NOC(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H7N3O5/c9-7(10-16-8(12)13)5-1-3-6(4-2-5)11(14)15/h1-4H,(H2,9,10)(H,12,13) |
| InChIKey | QSTDIJAXVNTEPX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 128.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|