C18H12N4O6 — CID 19294222
[(Z)-[amino-(4-nitrophenyl)methylidene]amino] 4-(2,5-dioxopyrrol-1-yl)benzoate (PubChem CID 19294222) has the molecular formula C18H12N4O6 and a molecular weight of 380.32 g/mol. Its IUPAC name is [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 4-(2,5-dioxopyrrol-1-yl)benzoate.
| Compound Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 4-(2,5-dioxopyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 19294222 |
| Molecular Formula | C18H12N4O6 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 4-(2,5-dioxopyrrol-1-yl)benzoate |
| SMILES | N/C(=N\OC(=O)c1ccc(N2C(=O)C=CC2=O)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H12N4O6/c19-17(11-1-7-14(8-2-11)22(26)27)20-28-18(25)12-3-5-13(6-4-12)21-15(23)9-10-16(21)24/h1-10H,(H2,19,20) |
| InChIKey | WWPDVVFOZWGDAC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|