C12H9N5O6 — CID 19298189
[(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 19298189) has the molecular formula C12H9N5O6 and a molecular weight of 319.23 g/mol. Its IUPAC name is [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2,4-dioxo-1H-pyrimidine-6-carboxylate.
| Compound Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2,4-dioxo-1H-pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 19298189 |
| Molecular Formula | C12H9N5O6 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [(Z)-[amino-(4-nitrophenyl)methylidene]amino] 2,4-dioxo-1H-pyrimidine-6-carboxylate |
| SMILES | N/C(=N\OC(=O)c1cc(=O)[nH]c(=O)[nH]1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H9N5O6/c13-10(6-1-3-7(4-2-6)17(21)22)16-23-11(19)8-5-9(18)15-12(20)14-8/h1-5H,(H2,13,16)(H2,14,15,18,20) |
| InChIKey | GSEIHADGJNXMTG-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 173.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|