About [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate
[[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate (PubChem CID 2880335) has the molecular formula C12H9N3O5
and a molecular weight of 275.22 g/mol. Its IUPAC name is [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate.
Molecular Properties
| Compound Name | [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate |
| PubChem CID | 2880335 |
| Molecular Formula | C12H9N3O5 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate |
| SMILES | NC(=NOC(=O)c1ccco1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H9N3O5/c13-11(8-3-5-9(6-4-8)15(17)18)14-20-12(16)10-2-1-7-19-10/h1-7H,(H2,13,14) |
| InChIKey | INTOWVJEUWYCFQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate?
The IUPAC name of [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate (CID 2880335) is [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate.
What is the SMILES notation for [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate?
The canonical SMILES for [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate is NC(=NOC(=O)c1ccco1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate?
The InChIKey is INTOWVJEUWYCFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O5/c13-11(8-3-5-9(6-4-8)15(17)18)14-20-12(16)10-2-1-7-19-10/h1-7H,(H2,13,14).
What are the key properties of [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate?
[[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate has a molecular weight of 275.22 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(4-nitrophenyl)methylidene]amino] furan-2-carboxylate is sourced from PubChem (CID 2880335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).