C17H11NO7 — CID 71473178
[1,2-bis(furan-2-yl)-2-oxoethyl] 4-nitrobenzoate (PubChem CID 71473178) has the molecular formula C17H11NO7 and a molecular weight of 341.28 g/mol. Its IUPAC name is [1,2-bis(furan-2-yl)-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [1,2-bis(furan-2-yl)-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 71473178 |
| Molecular Formula | C17H11NO7 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | [1,2-bis(furan-2-yl)-2-oxoethyl] 4-nitrobenzoate |
| SMILES | O=C(OC(C(=O)c1ccco1)c1ccco1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H11NO7/c19-15(13-3-1-9-23-13)16(14-4-2-10-24-14)25-17(20)11-5-7-12(8-6-11)18(21)22/h1-10,16H |
| InChIKey | ORSKHNXOKMCVNH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 112.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|