C22H19NO9 — CID 139246576
[(1S)-2-[(R)-acetyloxy(furan-2-yl)methyl]-1-(furan-2-yl)-3-(4-nitrophenyl)-3-oxopropyl] acetate (PubChem CID 139246576) has the molecular formula C22H19NO9 and a molecular weight of 441.39 g/mol. Its IUPAC name is [(1S)-2-[(R)-acetyloxy(furan-2-yl)methyl]-1-(furan-2-yl)-3-(4-nitrophenyl)-3-oxopropyl] acetate.
| Compound Name | [(1S)-2-[(R)-acetyloxy(furan-2-yl)methyl]-1-(furan-2-yl)-3-(4-nitrophenyl)-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 139246576 |
| Molecular Formula | C22H19NO9 |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [(1S)-2-[(R)-acetyloxy(furan-2-yl)methyl]-1-(furan-2-yl)-3-(4-nitrophenyl)-3-oxopropyl] acetate |
| SMILES | CC(=O)O[C@H](c1ccco1)C(C(=O)c1ccc([N+](=O)[O-])cc1)[C@@H](OC(C)=O)c1ccco1 |
| InChI | InChI=1S/C22H19NO9/c1-13(24)31-21(17-5-3-11-29-17)19(22(32-14(2)25)18-6-4-12-30-18)20(26)15-7-9-16(10-8-15)23(27)28/h3-12,19,21-22H,1-2H3/t19?,21-,22+ |
| InChIKey | GNWZOMGMCCMFEK-XDNSSPFJSA-N |
| XLogP | 4.19 |
| TPSA | 139.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|