C12H13NO3 — CID 125484709
(2R)-2,3-dimethyl-1-(4-nitrophenyl)but-3-en-1-one (PubChem CID 125484709) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2R)-2,3-dimethyl-1-(4-nitrophenyl)but-3-en-1-one.
| Compound Name | (2R)-2,3-dimethyl-1-(4-nitrophenyl)but-3-en-1-one |
|---|---|
| PubChem CID | 125484709 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (2R)-2,3-dimethyl-1-(4-nitrophenyl)but-3-en-1-one |
| SMILES | C=C(C)[C@@H](C)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H13NO3/c1-8(2)9(3)12(14)10-4-6-11(7-5-10)13(15)16/h4-7,9H,1H2,2-3H3/t9-/m1/s1 |
| InChIKey | GWZFEOKMZREUCG-SECBINFHSA-N |
| XLogP | 2.99 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|