C20H19N3O6 — CID 7392679
ethyl (2R,3R,4S)-4-cyano-3-(furan-2-yl)-5-imino-2-(4-nitrobenzoyl)hexanoate (PubChem CID 7392679) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is ethyl (2R,3R,4S)-4-cyano-3-(furan-2-yl)-5-imino-2-(4-nitrobenzoyl)hexanoate.
| Compound Name | ethyl (2R,3R,4S)-4-cyano-3-(furan-2-yl)-5-imino-2-(4-nitrobenzoyl)hexanoate |
|---|---|
| PubChem CID | 7392679 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl (2R,3R,4S)-4-cyano-3-(furan-2-yl)-5-imino-2-(4-nitrobenzoyl)hexanoate |
| SMILES | [H]/N=C(\C)[C@@H](C#N)[C@@H](c1ccco1)[C@@H](C(=O)OCC)C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N3O6/c1-3-28-20(25)18(19(24)13-6-8-14(9-7-13)23(26)27)17(15(11-21)12(2)22)16-5-4-10-29-16/h4-10,15,17-18,22H,3H2,1-2H3/b22-12+/t15-,17+,18-/m1/s1 |
| InChIKey | FSKPLCNAIKHONN-FUUCVKPVSA-N |
| XLogP | 3.51 |
| TPSA | 147.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|