C17H11ClO5 — CID 28923982
[(1S)-1,2-bis(furan-2-yl)-2-oxoethyl] 4-chlorobenzoate (PubChem CID 28923982) has the molecular formula C17H11ClO5 and a molecular weight of 330.72 g/mol. Its IUPAC name is [(1S)-1,2-bis(furan-2-yl)-2-oxoethyl] 4-chlorobenzoate.
| Compound Name | [(1S)-1,2-bis(furan-2-yl)-2-oxoethyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 28923982 |
| Molecular Formula | C17H11ClO5 |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | [(1S)-1,2-bis(furan-2-yl)-2-oxoethyl] 4-chlorobenzoate |
| SMILES | O=C(O[C@H](C(=O)c1ccco1)c1ccco1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClO5/c18-12-7-5-11(6-8-12)17(20)23-16(14-4-2-10-22-14)15(19)13-3-1-9-21-13/h1-10,16H/t16-/m0/s1 |
| InChIKey | MZJNSUYYSMLRLA-INIZCTEOSA-N |
| XLogP | 4.31 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |