C23H17Cl2NO8 — CID 126392831
(2R,3S)-2,3-bis[(4-chlorobenzoyl)oxy]-4-(furan-2-ylmethylamino)-4-oxobutanoic acid (PubChem CID 126392831) has the molecular formula C23H17Cl2NO8 and a molecular weight of 506.29 g/mol. Its IUPAC name is (2R,3S)-2,3-bis[(4-chlorobenzoyl)oxy]-4-(furan-2-ylmethylamino)-4-oxobutanoic acid.
| Compound Name | (2R,3S)-2,3-bis[(4-chlorobenzoyl)oxy]-4-(furan-2-ylmethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126392831 |
| Molecular Formula | C23H17Cl2NO8 |
| Molecular Weight | 506.29 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | (2R,3S)-2,3-bis[(4-chlorobenzoyl)oxy]-4-(furan-2-ylmethylamino)-4-oxobutanoic acid |
| SMILES | O=C(O[C@H](C(=O)NCc1ccco1)[C@@H](OC(=O)c1ccc(Cl)cc1)C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17Cl2NO8/c24-15-7-3-13(4-8-15)22(30)33-18(20(27)26-12-17-2-1-11-32-17)19(21(28)29)34-23(31)14-5-9-16(25)10-6-14/h1-11,18-19H,12H2,(H,26,27)(H,28,29)/t18-,19+/m0/s1 |
| InChIKey | TXFDFWYXELHICQ-RBUKOAKNSA-N |
| XLogP | 3.74 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |