C23H19NO8 — CID 3413465
2,3-dibenzoyloxy-4-(furan-2-ylmethylamino)-4-oxobutanoic acid (PubChem CID 3413465) has the molecular formula C23H19NO8 and a molecular weight of 437.40 g/mol. Its IUPAC name is 2,3-dibenzoyloxy-4-(furan-2-ylmethylamino)-4-oxobutanoic acid.
| Compound Name | 2,3-dibenzoyloxy-4-(furan-2-ylmethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3413465 |
| Molecular Formula | C23H19NO8 |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2,3-dibenzoyloxy-4-(furan-2-ylmethylamino)-4-oxobutanoic acid |
| SMILES | O=C(OC(C(=O)O)C(OC(=O)c1ccccc1)C(=O)NCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C23H19NO8/c25-20(24-14-17-12-7-13-30-17)18(31-22(28)15-8-3-1-4-9-15)19(21(26)27)32-23(29)16-10-5-2-6-11-16/h1-13,18-19H,14H2,(H,24,25)(H,26,27) |
| InChIKey | YOIYPGRFCNTJIU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |