C22H19NO5 — CID 7470534
[(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 2-benzoylbenzoate (PubChem CID 7470534) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 2-benzoylbenzoate.
| Compound Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 2-benzoylbenzoate |
|---|---|
| PubChem CID | 7470534 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethylamino)-1-oxopropan-2-yl] 2-benzoylbenzoate |
| SMILES | C[C@@H](OC(=O)c1ccccc1C(=O)c1ccccc1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C22H19NO5/c1-15(21(25)23-14-17-10-7-13-27-17)28-22(26)19-12-6-5-11-18(19)20(24)16-8-3-2-4-9-16/h2-13,15H,14H2,1H3,(H,23,25)/t15-/m1/s1 |
| InChIKey | CMKOHNWACAYDPA-OAHLLOKOSA-N |
| XLogP | 3.37 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |