C16H15N3O4 — CID 2952849
[[amino-(4-nitrophenyl)methylidene]amino] 2,4-dimethylbenzoate (PubChem CID 2952849) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is [[amino-(4-nitrophenyl)methylidene]amino] 2,4-dimethylbenzoate.
| Compound Name | [[amino-(4-nitrophenyl)methylidene]amino] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 2952849 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | [[amino-(4-nitrophenyl)methylidene]amino] 2,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)ON=C(N)c2ccc([N+](=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C16H15N3O4/c1-10-3-8-14(11(2)9-10)16(20)23-18-15(17)12-4-6-13(7-5-12)19(21)22/h3-9H,1-2H3,(H2,17,18) |
| InChIKey | CMEUCDYFROIYHV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|