C30H23N4O2+ — CID 12915376
4-nitro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide (PubChem CID 12915376) has the molecular formula C30H23N4O2+ and a molecular weight of 471.54 g/mol. Its IUPAC name is 4-nitro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide.
| Compound Name | 4-nitro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 12915376 |
| Molecular Formula | C30H23N4O2+ |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-nitro-N'-(2,4,6-triphenylpyridin-1-ium-1-yl)benzenecarboximidamide |
| SMILES | N/C(=N\[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H23N4O2/c31-30(25-16-18-27(19-17-25)34(35)36)32-33-28(23-12-6-2-7-13-23)20-26(22-10-4-1-5-11-22)21-29(33)24-14-8-3-9-15-24/h1-21H,(H2,31,32)/q+1 |
| InChIKey | VUJGJDVDBYRDQB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|