C17H14FNO3 — CID 50901848
2-(4-fluorophenyl)-4-(4-methoxyphenyl)-3-methyl-1,3-oxazol-3-ium-5-olate (PubChem CID 50901848) has the molecular formula C17H14FNO3 and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-3-methyl-1,3-oxazol-3-ium-5-olate.
| Compound Name | 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-3-methyl-1,3-oxazol-3-ium-5-olate |
|---|---|
| PubChem CID | 50901848 |
| Molecular Formula | C17H14FNO3 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-(4-fluorophenyl)-4-(4-methoxyphenyl)-3-methyl-1,3-oxazol-3-ium-5-olate |
| SMILES | COc1ccc(-c2c([O-])oc(-c3ccc(F)cc3)[n+]2C)cc1 |
| InChI | InChI=1S/C17H14FNO3/c1-19-15(11-5-9-14(21-2)10-6-11)17(20)22-16(19)12-3-7-13(18)8-4-12/h3-10H,1-2H3 |
| InChIKey | GSCGIAWIMWMNCW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|