C14H9F2NO2 — CID 82233017
5,7-difluoro-2-(4-methoxyphenyl)-1,3-benzoxazole (PubChem CID 82233017) has the molecular formula C14H9F2NO2 and a molecular weight of 261.23 g/mol. Its IUPAC name is 5,7-difluoro-2-(4-methoxyphenyl)-1,3-benzoxazole.
| Compound Name | 5,7-difluoro-2-(4-methoxyphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 82233017 |
| Molecular Formula | C14H9F2NO2 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 5,7-difluoro-2-(4-methoxyphenyl)-1,3-benzoxazole |
| SMILES | COc1ccc(-c2nc3cc(F)cc(F)c3o2)cc1 |
| InChI | InChI=1S/C14H9F2NO2/c1-18-10-4-2-8(3-5-10)14-17-12-7-9(15)6-11(16)13(12)19-14/h2-7H,1H3 |
| InChIKey | RHTDZTVVEWAEAK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |