C17H19NO2 — CID 145409461
ethane;2-(4-methoxyphenyl)-7-methyl-1,3-benzoxazole (PubChem CID 145409461) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is ethane;2-(4-methoxyphenyl)-7-methyl-1,3-benzoxazole.
| Compound Name | ethane;2-(4-methoxyphenyl)-7-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 145409461 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethane;2-(4-methoxyphenyl)-7-methyl-1,3-benzoxazole |
| SMILES | CC.COc1ccc(-c2nc3cccc(C)c3o2)cc1 |
| InChI | InChI=1S/C15H13NO2.C2H6/c1-10-4-3-5-13-14(10)18-15(16-13)11-6-8-12(17-2)9-7-11;1-2/h3-9H,1-2H3;1-2H3 |
| InChIKey | ZLYDWOXNUUUTEK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |