About 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole
2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole (PubChem CID 57321541) has the molecular formula C16H11NO2
and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole |
| PubChem CID | 57321541 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole |
| SMILES | Cc1cccc2nc(-c3occ4ccccc34)oc12 |
| InChI | InChI=1S/C16H11NO2/c1-10-5-4-8-13-14(10)19-16(17-13)15-12-7-3-2-6-11(12)9-18-15/h2-9H,1H3 |
| InChIKey | XGXMHYQGEZYDPF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole?
The IUPAC name of 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole (CID 57321541) is 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole.
What is the SMILES notation for 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole?
The canonical SMILES for 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole is Cc1cccc2nc(-c3occ4ccccc34)oc12.
What is the InChIKey of 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole?
The InChIKey is XGXMHYQGEZYDPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO2/c1-10-5-4-8-13-14(10)19-16(17-13)15-12-7-3-2-6-11(12)9-18-15/h2-9H,1H3.
What are the key properties of 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole?
2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole has a molecular weight of 249.27 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-benzofuran-1-yl)-7-methyl-1,3-benzoxazole is sourced from PubChem (CID 57321541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).