C14H11NO2 — CID 84689691
2-(2-methylphenyl)-1,3-benzoxazol-7-ol (PubChem CID 84689691) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1,3-benzoxazol-7-ol.
| Compound Name | 2-(2-methylphenyl)-1,3-benzoxazol-7-ol |
|---|---|
| PubChem CID | 84689691 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2-(2-methylphenyl)-1,3-benzoxazol-7-ol |
| SMILES | Cc1ccccc1-c1nc2cccc(O)c2o1 |
| InChI | InChI=1S/C14H11NO2/c1-9-5-2-3-6-10(9)14-15-11-7-4-8-12(16)13(11)17-14/h2-8,16H,1H3 |
| InChIKey | NNPLTTVEMBNXPH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |