About 10-methylnaphtho[1,2-b][1]benzofuran
10-methylnaphtho[1,2-b][1]benzofuran (PubChem CID 58510874) has the molecular formula C17H12O
and a molecular weight of 232.28 g/mol. Its IUPAC name is 10-methylnaphtho[1,2-b][1]benzofuran.
Molecular Properties
| Compound Name | 10-methylnaphtho[1,2-b][1]benzofuran |
| PubChem CID | 58510874 |
| Molecular Formula | C17H12O |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 10-methylnaphtho[1,2-b][1]benzofuran |
| SMILES | Cc1cccc2c1oc1c3ccccc3ccc21 |
| InChI | InChI=1S/C17H12O/c1-11-5-4-8-14-15-10-9-12-6-2-3-7-13(12)17(15)18-16(11)14/h2-10H,1H3 |
| InChIKey | WLFKRZITUYLICD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-methylnaphtho[1,2-b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylnaphtho[1,2-b][1]benzofuran?
The IUPAC name of 10-methylnaphtho[1,2-b][1]benzofuran (CID 58510874) is 10-methylnaphtho[1,2-b][1]benzofuran.
What is the SMILES notation for 10-methylnaphtho[1,2-b][1]benzofuran?
The canonical SMILES for 10-methylnaphtho[1,2-b][1]benzofuran is Cc1cccc2c1oc1c3ccccc3ccc21.
What is the InChIKey of 10-methylnaphtho[1,2-b][1]benzofuran?
The InChIKey is WLFKRZITUYLICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O/c1-11-5-4-8-14-15-10-9-12-6-2-3-7-13(12)17(15)18-16(11)14/h2-10H,1H3.
What are the key properties of 10-methylnaphtho[1,2-b][1]benzofuran?
10-methylnaphtho[1,2-b][1]benzofuran has a molecular weight of 232.28 g/mol, XLogP of 5.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylnaphtho[1,2-b][1]benzofuran is sourced from PubChem (CID 58510874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).