C25H19NO — CID 177124603
methyl-[(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)methylidene]-phenylazanium (PubChem CID 177124603) has the molecular formula C25H19NO and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl-[(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)methylidene]-phenylazanium.
| Compound Name | methyl-[(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)methylidene]-phenylazanium |
|---|---|
| PubChem CID | 177124603 |
| Molecular Formula | C25H19NO |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl-[(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)methylidene]-phenylazanium |
| SMILES | Cc1ccc2c(oc3c4ccccc4ccc23)c1/[C-]=[N+](\C)c1ccccc1 |
| InChI | InChI=1S/C25H19NO/c1-17-12-14-21-22-15-13-18-8-6-7-11-20(18)24(22)27-25(21)23(17)16-26(2)19-9-4-3-5-10-19/h3-15H,1-2H3 |
| InChIKey | GWOHXUNRBLOYSN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 16.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|