C25H18NOY- — CID 177124602
methyl-[(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)methylidene]-phenylazanium;yttrium (PubChem CID 177124602) has the molecular formula C25H18NOY- and a molecular weight of 437.33 g/mol. Its IUPAC name is methyl-[(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)methylidene]-phenylazanium;yttrium.
| Compound Name | methyl-[(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)methylidene]-phenylazanium;yttrium |
|---|---|
| PubChem CID | 177124602 |
| Molecular Formula | C25H18NOY- |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | methyl-[(9-methylnaphtho[1,2-b][1]benzofuran-10-yl)methylidene]-phenylazanium;yttrium |
| SMILES | Cc1ccc2c(oc3c4ccccc4ccc23)c1/[C-]=[N+](\C)c1[c-]cccc1.[Y] |
| InChI | InChI=1S/C25H18NO.Y/c1-17-12-14-21-22-15-13-18-8-6-7-11-20(18)24(22)27-25(21)23(17)16-26(2)19-9-4-3-5-10-19;/h3-9,11-15H,1-2H3;/q-1; |
| InChIKey | BPSITOMERCSIBJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 16.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|