C17H14FNOS2 — CID 50901858
4-(4-fluorophenyl)-2-(4-methoxyphenyl)-3-methyl-1,3-thiazol-3-ium-5-thiolate (PubChem CID 50901858) has the molecular formula C17H14FNOS2 and a molecular weight of 331.44 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-(4-methoxyphenyl)-3-methyl-1,3-thiazol-3-ium-5-thiolate.
| Compound Name | 4-(4-fluorophenyl)-2-(4-methoxyphenyl)-3-methyl-1,3-thiazol-3-ium-5-thiolate |
|---|---|
| PubChem CID | 50901858 |
| Molecular Formula | C17H14FNOS2 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-(4-fluorophenyl)-2-(4-methoxyphenyl)-3-methyl-1,3-thiazol-3-ium-5-thiolate |
| SMILES | COc1ccc(-c2sc([S-])c(-c3ccc(F)cc3)[n+]2C)cc1 |
| InChI | InChI=1S/C17H14FNOS2/c1-19-15(11-3-7-13(18)8-4-11)17(21)22-16(19)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | ZDLVBHPSCUOHNE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|