C12H15IN2OS — CID 154879189
4-(4-methoxyphenyl)-3,5-dimethyl-1,3-thiazol-3-ium-2-amine iodide (PubChem CID 154879189) has the molecular formula C12H15IN2OS and a molecular weight of 362.24 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3,5-dimethyl-1,3-thiazol-3-ium-2-amine iodide.
| Compound Name | 4-(4-methoxyphenyl)-3,5-dimethyl-1,3-thiazol-3-ium-2-amine iodide |
|---|---|
| PubChem CID | 154879189 |
| Molecular Formula | C12H15IN2OS |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 4-(4-methoxyphenyl)-3,5-dimethyl-1,3-thiazol-3-ium-2-amine iodide |
| SMILES | COc1ccc(-c2c(C)sc(N)[n+]2C)cc1.[I-] |
| InChI | InChI=1S/C12H14N2OS.HI/c1-8-11(14(2)12(13)16-8)9-4-6-10(15-3)7-5-9;/h4-7,13H,1-3H3;1H |
| InChIKey | ZOVUBVDAGSYOLA-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 39.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|