C13H13BrOS — CID 134832933
3-bromo-4-(4-methoxyphenyl)-2,5-dimethylthiophene (PubChem CID 134832933) has the molecular formula C13H13BrOS and a molecular weight of 297.22 g/mol. Its IUPAC name is 3-bromo-4-(4-methoxyphenyl)-2,5-dimethylthiophene.
| Compound Name | 3-bromo-4-(4-methoxyphenyl)-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 134832933 |
| Molecular Formula | C13H13BrOS |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 3-bromo-4-(4-methoxyphenyl)-2,5-dimethylthiophene |
| SMILES | COc1ccc(-c2c(C)sc(C)c2Br)cc1 |
| InChI | InChI=1S/C13H13BrOS/c1-8-12(13(14)9(2)16-8)10-4-6-11(15-3)7-5-10/h4-7H,1-3H3 |
| InChIKey | UAQLGCDMFHCKBN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |