C13H8Br2OS2 — CID 122480470
2,5-dibromo-6-(4-methoxyphenyl)thieno[3,2-b]thiophene (PubChem CID 122480470) has the molecular formula C13H8Br2OS2 and a molecular weight of 404.15 g/mol. Its IUPAC name is 2,5-dibromo-6-(4-methoxyphenyl)thieno[3,2-b]thiophene.
| Compound Name | 2,5-dibromo-6-(4-methoxyphenyl)thieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 122480470 |
| Molecular Formula | C13H8Br2OS2 |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 401.84 |
| IUPAC Name | 2,5-dibromo-6-(4-methoxyphenyl)thieno[3,2-b]thiophene |
| SMILES | COc1ccc(-c2c(Br)sc3cc(Br)sc23)cc1 |
| InChI | InChI=1S/C13H8Br2OS2/c1-16-8-4-2-7(3-5-8)11-12-9(17-13(11)15)6-10(14)18-12/h2-6H,1H3 |
| InChIKey | DAGFPNWMRLWSRE-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |