C28H20O2S2 — CID 126549760
2,7-bis(4-methoxyphenyl)-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 126549760) has the molecular formula C28H20O2S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 2,7-bis(4-methoxyphenyl)-[1]benzothiolo[3,2-b][1]benzothiole.
| Compound Name | 2,7-bis(4-methoxyphenyl)-[1]benzothiolo[3,2-b][1]benzothiole |
|---|---|
| PubChem CID | 126549760 |
| Molecular Formula | C28H20O2S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2,7-bis(4-methoxyphenyl)-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | COc1ccc(-c2ccc3c(c2)sc2c4ccc(-c5ccc(OC)cc5)cc4sc32)cc1 |
| InChI | InChI=1S/C28H20O2S2/c1-29-21-9-3-17(4-10-21)19-7-13-23-25(15-19)31-28-24-14-8-20(16-26(24)32-27(23)28)18-5-11-22(30-2)12-6-18/h3-16H,1-2H3 |
| InChIKey | PBKBGKYSCLFURV-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |