C28H14Cl6S2 — CID 163746907
2,7-bis[4-(trichloromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 163746907) has the molecular formula C28H14Cl6S2 and a molecular weight of 627.27 g/mol. Its IUPAC name is 2,7-bis[4-(trichloromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole.
| Compound Name | 2,7-bis[4-(trichloromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole |
|---|---|
| PubChem CID | 163746907 |
| Molecular Formula | C28H14Cl6S2 |
| Molecular Weight | 627.27 g/mol |
| Exact Mass | 623.87 |
| IUPAC Name | 2,7-bis[4-(trichloromethyl)phenyl]-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | ClC(Cl)(Cl)c1ccc(-c2ccc3c(c2)sc2c4ccc(-c5ccc(C(Cl)(Cl)Cl)cc5)cc4sc32)cc1 |
| InChI | InChI=1S/C28H14Cl6S2/c29-27(30,31)19-7-1-15(2-8-19)17-5-11-21-23(13-17)35-26-22-12-6-18(14-24(22)36-25(21)26)16-3-9-20(10-4-16)28(32,33)34/h1-14H |
| InChIKey | LMQQILZGWYEKCY-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.27 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|