C14H6Cl2S2 — CID 12549782
2,7-dichloro-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 12549782) has the molecular formula C14H6Cl2S2 and a molecular weight of 309.24 g/mol. Its IUPAC name is 2,7-dichloro-[1]benzothiolo[3,2-b][1]benzothiole.
| Compound Name | 2,7-dichloro-[1]benzothiolo[3,2-b][1]benzothiole |
|---|---|
| PubChem CID | 12549782 |
| Molecular Formula | C14H6Cl2S2 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 307.93 |
| IUPAC Name | 2,7-dichloro-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | Clc1ccc2c(c1)sc1c3ccc(Cl)cc3sc21 |
| InChI | InChI=1S/C14H6Cl2S2/c15-7-1-3-9-11(5-7)17-14-10-4-2-8(16)6-12(10)18-13(9)14/h1-6H |
| InChIKey | OVHLNXRHESZRDX-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |