C12H5ClF2S — CID 156704591
7-chloro-2,4-difluorodibenzothiophene (PubChem CID 156704591) has the molecular formula C12H5ClF2S and a molecular weight of 254.69 g/mol. Its IUPAC name is 7-chloro-2,4-difluorodibenzothiophene.
| Compound Name | 7-chloro-2,4-difluorodibenzothiophene |
|---|---|
| PubChem CID | 156704591 |
| Molecular Formula | C12H5ClF2S |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 7-chloro-2,4-difluorodibenzothiophene |
| SMILES | Fc1cc(F)c2sc3cc(Cl)ccc3c2c1 |
| InChI | InChI=1S/C12H5ClF2S/c13-6-1-2-8-9-4-7(14)5-10(15)12(9)16-11(8)3-6/h1-5H |
| InChIKey | ZIULBJWKKFUJNP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |