C8H3F3S — CID 130786065
2,5,7-trifluoro-1-benzothiophene (PubChem CID 130786065) has the molecular formula C8H3F3S and a molecular weight of 188.17 g/mol. Its IUPAC name is 2,5,7-trifluoro-1-benzothiophene.
| Compound Name | 2,5,7-trifluoro-1-benzothiophene |
|---|---|
| PubChem CID | 130786065 |
| Molecular Formula | C8H3F3S |
| Molecular Weight | 188.17 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 2,5,7-trifluoro-1-benzothiophene |
| SMILES | Fc1cc(F)c2sc(F)cc2c1 |
| InChI | InChI=1S/C8H3F3S/c9-5-1-4-2-7(11)12-8(4)6(10)3-5/h1-3H |
| InChIKey | DPEHUOBTUZSDES-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |