C6H7F7S — CID 173125466
2,4,6-trifluorobenzenethiol;tetrahydrofluoride (PubChem CID 173125466) has the molecular formula C6H7F7S and a molecular weight of 244.18 g/mol. Its IUPAC name is 2,4,6-trifluorobenzenethiol;tetrahydrofluoride.
| Compound Name | 2,4,6-trifluorobenzenethiol;tetrahydrofluoride |
|---|---|
| PubChem CID | 173125466 |
| Molecular Formula | C6H7F7S |
| Molecular Weight | 244.18 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 2,4,6-trifluorobenzenethiol;tetrahydrofluoride |
| SMILES | F.F.F.F.Fc1cc(F)c(S)c(F)c1 |
| InChI | InChI=1S/C6H3F3S.4FH/c7-3-1-4(8)6(10)5(9)2-3;;;;/h1-2,10H;4*1H |
| InChIKey | PPQXRXKADRJPFZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|